C12H18N4O3S — CID 61253139
N-methyl-4-(piperazin-1-ylsulfonylamino)benzamide (PubChem CID 61253139) has the molecular formula C12H18N4O3S and a molecular weight of 298.37 g/mol. Its IUPAC name is N-methyl-4-(piperazin-1-ylsulfonylamino)benzamide.
| Compound Name | N-methyl-4-(piperazin-1-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 61253139 |
| Molecular Formula | C12H18N4O3S |
| Molecular Weight | 298.37 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-methyl-4-(piperazin-1-ylsulfonylamino)benzamide |
| SMILES | CNC(=O)c1ccc(NS(=O)(=O)N2CCNCC2)cc1 |
| InChI | InChI=1S/C12H18N4O3S/c1-13-12(17)10-2-4-11(5-3-10)15-20(18,19)16-8-6-14-7-9-16/h2-5,14-15H,6-9H2,1H3,(H,13,17) |
| InChIKey | YWRHAEVPKLXGGY-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.37 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |