C12H17FN4O3S — CID 61252527
N-[4-fluoro-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide (PubChem CID 61252527) has the molecular formula C12H17FN4O3S and a molecular weight of 316.36 g/mol. Its IUPAC name is N-[4-fluoro-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[4-fluoro-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 61252527 |
| Molecular Formula | C12H17FN4O3S |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[4-fluoro-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(F)c(NS(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C12H17FN4O3S/c1-9(18)15-10-2-3-11(13)12(8-10)16-21(19,20)17-6-4-14-5-7-17/h2-3,8,14,16H,4-7H2,1H3,(H,15,18) |
| InChIKey | WEDPUSQTJDENOP-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |