C13H20N4O3S — CID 61251789
N-[4-methyl-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide (PubChem CID 61251789) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is N-[4-methyl-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide.
| Compound Name | N-[4-methyl-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 61251789 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | N-[4-methyl-3-(piperazin-1-ylsulfonylamino)phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C)c(NS(=O)(=O)N2CCNCC2)c1 |
| InChI | InChI=1S/C13H20N4O3S/c1-10-3-4-12(15-11(2)18)9-13(10)16-21(19,20)17-7-5-14-6-8-17/h3-4,9,14,16H,5-8H2,1-2H3,(H,15,18) |
| InChIKey | UZOITCCCUYSGLX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |