C7H8N6 — CID 61253577
N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-4-amine (PubChem CID 61253577) has the molecular formula C7H8N6 and a molecular weight of 176.18 g/mol. Its IUPAC name is N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-4-amine.
| Compound Name | N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 61253577 |
| Molecular Formula | C7H8N6 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | N-(1H-1,2,4-triazol-5-ylmethyl)pyrimidin-4-amine |
| SMILES | c1cc(NCc2ncn[nH]2)ncn1 |
| InChI | InChI=1S/C7H8N6/c1-2-8-4-10-6(1)9-3-7-11-5-12-13-7/h1-2,4-5H,3H2,(H,8,9,10)(H,11,12,13) |
| InChIKey | ZLTYHASEZOBSRQ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |