C11H22F3N3O2S — CID 61253719
N-pentan-3-yl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide (PubChem CID 61253719) has the molecular formula C11H22F3N3O2S and a molecular weight of 317.38 g/mol. Its IUPAC name is N-pentan-3-yl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide.
| Compound Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 61253719 |
| Molecular Formula | C11H22F3N3O2S |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-pentan-3-yl-N-(2,2,2-trifluoroethyl)piperazine-1-sulfonamide |
| SMILES | CCC(CC)N(CC(F)(F)F)S(=O)(=O)N1CCNCC1 |
| InChI | InChI=1S/C11H22F3N3O2S/c1-3-10(4-2)17(9-11(12,13)14)20(18,19)16-7-5-15-6-8-16/h10,15H,3-9H2,1-2H3 |
| InChIKey | DHISYQJEHNDTOY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |