C19H20N2O4 — CID 6125753
6-hydroxy-2-(3-morpholin-4-ylpropyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 6125753) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-hydroxy-2-(3-morpholin-4-ylpropyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-hydroxy-2-(3-morpholin-4-ylpropyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 6125753 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 6-hydroxy-2-(3-morpholin-4-ylpropyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | O=C1c2cccc3c(O)ccc(c23)C(=O)N1CCCN1CCOCC1 |
| InChI | InChI=1S/C19H20N2O4/c22-16-6-5-15-17-13(16)3-1-4-14(17)18(23)21(19(15)24)8-2-7-20-9-11-25-12-10-20/h1,3-6,22H,2,7-12H2 |
| InChIKey | VODJOFZWABRAIL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|