C27H30N2O4Si — CID 102368939
2-(2-morpholin-4-ylethyl)-6-(4-trimethylsilyloxyphenyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 102368939) has the molecular formula C27H30N2O4Si and a molecular weight of 474.63 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethyl)-6-(4-trimethylsilyloxyphenyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-(2-morpholin-4-ylethyl)-6-(4-trimethylsilyloxyphenyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 102368939 |
| Molecular Formula | C27H30N2O4Si |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | 2-(2-morpholin-4-ylethyl)-6-(4-trimethylsilyloxyphenyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | C[Si](C)(C)Oc1ccc(-c2ccc3c4c(cccc24)C(=O)N(CCN2CCOCC2)C3=O)cc1 |
| InChI | InChI=1S/C27H30N2O4Si/c1-34(2,3)33-20-9-7-19(8-10-20)21-11-12-24-25-22(21)5-4-6-23(25)26(30)29(27(24)31)14-13-28-15-17-32-18-16-28/h4-12H,13-18H2,1-3H3 |
| InChIKey | RGCUVFKTWPCHIT-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|