C18H20N4O3 — CID 132937127
6-hydrazinyl-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione (PubChem CID 132937127) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 6-hydrazinyl-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 6-hydrazinyl-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 132937127 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 6-hydrazinyl-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione |
| SMILES | NNc1ccc2c3c(cccc13)C(=O)N(CCN1CCOCC1)C2=O |
| InChI | InChI=1S/C18H20N4O3/c19-20-15-5-4-14-16-12(15)2-1-3-13(16)17(23)22(18(14)24)7-6-21-8-10-25-11-9-21/h1-5,20H,6-11,19H2 |
| InChIKey | MXLCMEMNHPCREM-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|