C11H12Br2N2O2 — CID 61272365
N-(4-amino-2,6-dibromophenyl)oxolane-3-carboxamide (PubChem CID 61272365) has the molecular formula C11H12Br2N2O2 and a molecular weight of 364.04 g/mol. Its IUPAC name is N-(4-amino-2,6-dibromophenyl)oxolane-3-carboxamide.
| Compound Name | N-(4-amino-2,6-dibromophenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 61272365 |
| Molecular Formula | C11H12Br2N2O2 |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | N-(4-amino-2,6-dibromophenyl)oxolane-3-carboxamide |
| SMILES | Nc1cc(Br)c(NC(=O)C2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C11H12Br2N2O2/c12-8-3-7(14)4-9(13)10(8)15-11(16)6-1-2-17-5-6/h3-4,6H,1-2,5,14H2,(H,15,16) |
| InChIKey | ZSWPYHORZJPHQE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|