C11H12Br2N2O — CID 43549410
N-(4-amino-2,6-dibromophenyl)-2-methylcyclopropane-1-carboxamide (PubChem CID 43549410) has the molecular formula C11H12Br2N2O and a molecular weight of 348.04 g/mol. Its IUPAC name is N-(4-amino-2,6-dibromophenyl)-2-methylcyclopropane-1-carboxamide.
| Compound Name | N-(4-amino-2,6-dibromophenyl)-2-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43549410 |
| Molecular Formula | C11H12Br2N2O |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | N-(4-amino-2,6-dibromophenyl)-2-methylcyclopropane-1-carboxamide |
| SMILES | CC1CC1C(=O)Nc1c(Br)cc(N)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O/c1-5-2-7(5)11(16)15-10-8(12)3-6(14)4-9(10)13/h3-5,7H,2,14H2,1H3,(H,15,16) |
| InChIKey | FDYYQOUVESGPTD-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|