C10H10Br2N2O — CID 43549427
N-(4-amino-2,6-dibromophenyl)cyclopropanecarboxamide (PubChem CID 43549427) has the molecular formula C10H10Br2N2O and a molecular weight of 334.01 g/mol. Its IUPAC name is N-(4-amino-2,6-dibromophenyl)cyclopropanecarboxamide.
| Compound Name | N-(4-amino-2,6-dibromophenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 43549427 |
| Molecular Formula | C10H10Br2N2O |
| Molecular Weight | 334.01 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | N-(4-amino-2,6-dibromophenyl)cyclopropanecarboxamide |
| SMILES | Nc1cc(Br)c(NC(=O)C2CC2)c(Br)c1 |
| InChI | InChI=1S/C10H10Br2N2O/c11-7-3-6(13)4-8(12)9(7)14-10(15)5-1-2-5/h3-5H,1-2,13H2,(H,14,15) |
| InChIKey | KJVMYQABZUVVPK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.01 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|