About 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde
1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde (PubChem CID 61272654) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde |
| PubChem CID | 61272654 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde |
| SMILES | CCC(C)n1nc(C)c(C=O)c1C |
| InChI | InChI=1S/C10H16N2O/c1-5-7(2)12-9(4)10(6-13)8(3)11-12/h6-7H,5H2,1-4H3 |
| InChIKey | JWQFGSNYTCIOFY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde?
The IUPAC name of 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde (CID 61272654) is 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde.
What is the SMILES notation for 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde?
The canonical SMILES for 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde is CCC(C)n1nc(C)c(C=O)c1C.
What is the InChIKey of 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde?
The InChIKey is JWQFGSNYTCIOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c1-5-7(2)12-9(4)10(6-13)8(3)11-12/h6-7H,5H2,1-4H3.
What are the key properties of 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde?
1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde has a molecular weight of 180.25 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-3,5-dimethylpyrazole-4-carbaldehyde is sourced from PubChem (CID 61272654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).