C15H18O2 — CID 61272773
oxolan-3-yl(5,6,7,8-tetrahydronaphthalen-2-yl)methanone (PubChem CID 61272773) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is oxolan-3-yl(5,6,7,8-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | oxolan-3-yl(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 61272773 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | oxolan-3-yl(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCCC2)C1CCOC1 |
| InChI | InChI=1S/C15H18O2/c16-15(14-7-8-17-10-14)13-6-5-11-3-1-2-4-12(11)9-13/h5-6,9,14H,1-4,7-8,10H2 |
| InChIKey | YISRVEWDKVGFQL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |