C21H30N2O4 — CID 143860761
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;5,6,7,8-tetrahydronaphthalene-2-carboxamide (PubChem CID 143860761) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;5,6,7,8-tetrahydronaphthalene-2-carboxamide.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;5,6,7,8-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 143860761 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan;cyclopropanecarboxamide;5,6,7,8-tetrahydronaphthalene-2-carboxamide |
| SMILES | C1CC2OCCC2O1.NC(=O)C1CC1.NC(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H13NO.C6H10O2.C4H7NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;1-3-7-6-2-4-8-5(1)6;5-4(6)3-1-2-3/h5-7H,1-4H2,(H2,12,13);5-6H,1-4H2;3H,1-2H2,(H2,5,6) |
| InChIKey | FTLFGZFSNOIOIP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |