C12H11NO4 — CID 61273175
6-(oxolane-3-carbonyl)-3H-1,3-benzoxazol-2-one (PubChem CID 61273175) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 6-(oxolane-3-carbonyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(oxolane-3-carbonyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 61273175 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 6-(oxolane-3-carbonyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2[nH]c(=O)oc2c1)C1CCOC1 |
| InChI | InChI=1S/C12H11NO4/c14-11(8-3-4-16-6-8)7-1-2-9-10(5-7)17-12(15)13-9/h1-2,5,8H,3-4,6H2,(H,13,15) |
| InChIKey | QQXTUWRGCKHFHA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |