C15H21NO5 — CID 61277625
oxan-2-ylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 61277625) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is oxan-2-ylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | oxan-2-ylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 61277625 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | oxan-2-ylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)OCC1CCCCO1 |
| InChI | InChI=1S/C15H21NO5/c16-12(7-10-4-5-13(17)14(18)8-10)15(19)21-9-11-3-1-2-6-20-11/h4-5,8,11-12,17-18H,1-3,6-7,9,16H2/t11?,12-/m0/s1 |
| InChIKey | CKQVNRKKUKIUQW-KIYNQFGBSA-N |
| XLogP | 1.08 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|