C16H23NO4 — CID 62384000
cyclohexylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate (PubChem CID 62384000) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is cyclohexylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate.
| Compound Name | cyclohexylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 62384000 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | cyclohexylmethyl (2S)-2-amino-3-(3,4-dihydroxyphenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc(O)c(O)c1)C(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C16H23NO4/c17-13(8-12-6-7-14(18)15(19)9-12)16(20)21-10-11-4-2-1-3-5-11/h6-7,9,11,13,18-19H,1-5,8,10,17H2/t13-/m0/s1 |
| InChIKey | GOBSAGFPWBHLGP-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|