C12H15ClN4O — CID 61283741
4-chloro-1-propyl-N-(1H-pyrazol-5-ylmethyl)pyrrole-2-carboxamide (PubChem CID 61283741) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 4-chloro-1-propyl-N-(1H-pyrazol-5-ylmethyl)pyrrole-2-carboxamide.
| Compound Name | 4-chloro-1-propyl-N-(1H-pyrazol-5-ylmethyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 61283741 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-chloro-1-propyl-N-(1H-pyrazol-5-ylmethyl)pyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)NCc1ccn[nH]1 |
| InChI | InChI=1S/C12H15ClN4O/c1-2-5-17-8-9(13)6-11(17)12(18)14-7-10-3-4-15-16-10/h3-4,6,8H,2,5,7H2,1H3,(H,14,18)(H,15,16) |
| InChIKey | KLEBGLMJDSEXEG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |