C14H15ClN2O4 — CID 79994265
5-[[(4-chloro-1-propylpyrrole-2-carbonyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 79994265) has the molecular formula C14H15ClN2O4 and a molecular weight of 310.74 g/mol. Its IUPAC name is 5-[[(4-chloro-1-propylpyrrole-2-carbonyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(4-chloro-1-propylpyrrole-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79994265 |
| Molecular Formula | C14H15ClN2O4 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 5-[[(4-chloro-1-propylpyrrole-2-carbonyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | CCCn1cc(Cl)cc1C(=O)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C14H15ClN2O4/c1-2-5-17-8-9(15)6-11(17)13(18)16-7-10-3-4-12(21-10)14(19)20/h3-4,6,8H,2,5,7H2,1H3,(H,16,18)(H,19,20) |
| InChIKey | PALDGCJVMDIUSS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |