C13H17ClN4O — CID 104620364
4-chloro-N-(4-ethyl-1H-pyrazol-5-yl)-1-propylpyrrole-2-carboxamide (PubChem CID 104620364) has the molecular formula C13H17ClN4O and a molecular weight of 280.76 g/mol. Its IUPAC name is 4-chloro-N-(4-ethyl-1H-pyrazol-5-yl)-1-propylpyrrole-2-carboxamide.
| Compound Name | 4-chloro-N-(4-ethyl-1H-pyrazol-5-yl)-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 104620364 |
| Molecular Formula | C13H17ClN4O |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 4-chloro-N-(4-ethyl-1H-pyrazol-5-yl)-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)Nc1[nH]ncc1CC |
| InChI | InChI=1S/C13H17ClN4O/c1-3-5-18-8-10(14)6-11(18)13(19)16-12-9(4-2)7-15-17-12/h6-8H,3-5H2,1-2H3,(H2,15,16,17,19) |
| InChIKey | OFDKQLUESXLTIG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |