C16H18BrClN2O — CID 81288414
N-(4-bromo-2-ethylphenyl)-4-chloro-1-propylpyrrole-2-carboxamide (PubChem CID 81288414) has the molecular formula C16H18BrClN2O and a molecular weight of 369.69 g/mol. Its IUPAC name is N-(4-bromo-2-ethylphenyl)-4-chloro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-(4-bromo-2-ethylphenyl)-4-chloro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 81288414 |
| Molecular Formula | C16H18BrClN2O |
| Molecular Weight | 369.69 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | N-(4-bromo-2-ethylphenyl)-4-chloro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)Nc1ccc(Br)cc1CC |
| InChI | InChI=1S/C16H18BrClN2O/c1-3-7-20-10-13(18)9-15(20)16(21)19-14-6-5-12(17)8-11(14)4-2/h5-6,8-10H,3-4,7H2,1-2H3,(H,19,21) |
| InChIKey | OJDMAHKDQLTRAT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.69 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |