C14H12BrClF2N2O — CID 65498938
N-(4-bromo-2,6-difluorophenyl)-4-chloro-1-propylpyrrole-2-carboxamide (PubChem CID 65498938) has the molecular formula C14H12BrClF2N2O and a molecular weight of 377.62 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)-4-chloro-1-propylpyrrole-2-carboxamide.
| Compound Name | N-(4-bromo-2,6-difluorophenyl)-4-chloro-1-propylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 65498938 |
| Molecular Formula | C14H12BrClF2N2O |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 375.98 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)-4-chloro-1-propylpyrrole-2-carboxamide |
| SMILES | CCCn1cc(Cl)cc1C(=O)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C14H12BrClF2N2O/c1-2-3-20-7-9(16)6-12(20)14(21)19-13-10(17)4-8(15)5-11(13)18/h4-7H,2-3H2,1H3,(H,19,21) |
| InChIKey | KIUTXNKNSBFGPI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |