C13H11BrClFN2O — CID 43639461
N-(4-bromo-2-fluorophenyl)-4-chloro-1-ethylpyrrole-2-carboxamide (PubChem CID 43639461) has the molecular formula C13H11BrClFN2O and a molecular weight of 345.60 g/mol. Its IUPAC name is N-(4-bromo-2-fluorophenyl)-4-chloro-1-ethylpyrrole-2-carboxamide.
| Compound Name | N-(4-bromo-2-fluorophenyl)-4-chloro-1-ethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43639461 |
| Molecular Formula | C13H11BrClFN2O |
| Molecular Weight | 345.60 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | N-(4-bromo-2-fluorophenyl)-4-chloro-1-ethylpyrrole-2-carboxamide |
| SMILES | CCn1cc(Cl)cc1C(=O)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C13H11BrClFN2O/c1-2-18-7-9(15)6-12(18)13(19)17-11-4-3-8(14)5-10(11)16/h3-7H,2H2,1H3,(H,17,19) |
| InChIKey | CFQRRUYLHGENQJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.60 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |