C10H9F2N3S — CID 61285822
2,6-difluoro-1-N-(1,3-thiazol-2-ylmethyl)benzene-1,4-diamine (PubChem CID 61285822) has the molecular formula C10H9F2N3S and a molecular weight of 241.27 g/mol. Its IUPAC name is 2,6-difluoro-1-N-(1,3-thiazol-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2,6-difluoro-1-N-(1,3-thiazol-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 61285822 |
| Molecular Formula | C10H9F2N3S |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | 2,6-difluoro-1-N-(1,3-thiazol-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1cc(F)c(NCc2nccs2)c(F)c1 |
| InChI | InChI=1S/C10H9F2N3S/c11-7-3-6(13)4-8(12)10(7)15-5-9-14-1-2-16-9/h1-4,15H,5,13H2 |
| InChIKey | QVZCSZWEWFYXEX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|