C13H22N2O2 — CID 61289943
3-tert-butyl-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione (PubChem CID 61289943) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 3-tert-butyl-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione.
| Compound Name | 3-tert-butyl-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 61289943 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 3-tert-butyl-8-methyl-1,3-diazaspiro[4.5]decane-2,4-dione |
| SMILES | CC1CCC2(CC1)NC(=O)N(C(C)(C)C)C2=O |
| InChI | InChI=1S/C13H22N2O2/c1-9-5-7-13(8-6-9)10(16)15(11(17)14-13)12(2,3)4/h9H,5-8H2,1-4H3,(H,14,17) |
| InChIKey | OFCWUUGUYIXUCY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|