C15H28N2O2 — CID 166023009
3,5,5-tritert-butylimidazolidine-2,4-dione (PubChem CID 166023009) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 3,5,5-tritert-butylimidazolidine-2,4-dione.
| Compound Name | 3,5,5-tritert-butylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166023009 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3,5,5-tritert-butylimidazolidine-2,4-dione |
| SMILES | CC(C)(C)N1C(=O)NC(C(C)(C)C)(C(C)(C)C)C1=O |
| InChI | InChI=1S/C15H28N2O2/c1-12(2,3)15(13(4,5)6)10(18)17(11(19)16-15)14(7,8)9/h1-9H3,(H,16,19) |
| InChIKey | SICRXNLHGOKHGW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|