C23H38O4 — CID 613004
methyl 3-[7-(1-hydroxybutyl)-3a,6-dimethyl-3-oxo-1,2,4,5,5a,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate (PubChem CID 613004) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is methyl 3-[7-(1-hydroxybutyl)-3a,6-dimethyl-3-oxo-1,2,4,5,5a,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate.
| Compound Name | methyl 3-[7-(1-hydroxybutyl)-3a,6-dimethyl-3-oxo-1,2,4,5,5a,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
|---|---|
| PubChem CID | 613004 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | methyl 3-[7-(1-hydroxybutyl)-3a,6-dimethyl-3-oxo-1,2,4,5,5a,7,8,9,9a,9b-decahydrocyclopenta[a]naphthalen-6-yl]propanoate |
| SMILES | CCCC(O)C1CCC2C3CCC(=O)C3(C)CCC2C1(C)CCC(=O)OC |
| InChI | InChI=1S/C23H38O4/c1-5-6-19(24)18-8-7-15-16-9-10-20(25)23(16,3)13-11-17(15)22(18,2)14-12-21(26)27-4/h15-19,24H,5-14H2,1-4H3 |
| InChIKey | PWIJWFCVPPUWSD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |