C13H20N2O4S2 — CID 61301354
ethyl 4-[(4-aminothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate (PubChem CID 61301354) has the molecular formula C13H20N2O4S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is ethyl 4-[(4-aminothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(4-aminothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 61301354 |
| Molecular Formula | C13H20N2O4S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | ethyl 4-[(4-aminothiophen-2-yl)sulfonylamino]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(NS(=O)(=O)c2cc(N)cs2)CC1 |
| InChI | InChI=1S/C13H20N2O4S2/c1-2-19-13(16)9-3-5-11(6-4-9)15-21(17,18)12-7-10(14)8-20-12/h7-9,11,15H,2-6,14H2,1H3 |
| InChIKey | AEDXBXGOYIBODM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |