About quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate
quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate (PubChem CID 61314842) has the molecular formula C15H14N4O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate |
| PubChem CID | 61314842 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate |
| SMILES | Nc1cnn(CC(=O)OCc2ccc3ccccc3n2)c1 |
| InChI | InChI=1S/C15H14N4O2/c16-12-7-17-19(8-12)9-15(20)21-10-13-6-5-11-3-1-2-4-14(11)18-13/h1-8H,9-10,16H2 |
| InChIKey | JRJSOBKMRPFDBR-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate?
The IUPAC name of quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate (CID 61314842) is quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate.
What is the SMILES notation for quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate?
The canonical SMILES for quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate is Nc1cnn(CC(=O)OCc2ccc3ccccc3n2)c1.
What is the InChIKey of quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate?
The InChIKey is JRJSOBKMRPFDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c16-12-7-17-19(8-12)9-15(20)21-10-13-6-5-11-3-1-2-4-14(11)18-13/h1-8H,9-10,16H2.
What are the key properties of quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate?
quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate has a molecular weight of 282.30 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for quinolin-2-ylmethyl 2-(4-aminopyrazol-1-yl)acetate is sourced from PubChem (CID 61314842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).