About 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate
1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate (PubChem CID 61285964) has the molecular formula C13H15N3O2
and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate.
Molecular Properties
| Compound Name | 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate |
| PubChem CID | 61285964 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate |
| SMILES | CC(OC(=O)Cn1cc(N)cn1)c1ccccc1 |
| InChI | InChI=1S/C13H15N3O2/c1-10(11-5-3-2-4-6-11)18-13(17)9-16-8-12(14)7-15-16/h2-8,10H,9,14H2,1H3 |
| InChIKey | KORVKUWAAZAZBU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate?
The IUPAC name of 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate (CID 61285964) is 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate.
What is the SMILES notation for 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate?
The canonical SMILES for 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate is CC(OC(=O)Cn1cc(N)cn1)c1ccccc1.
What is the InChIKey of 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate?
The InChIKey is KORVKUWAAZAZBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2/c1-10(11-5-3-2-4-6-11)18-13(17)9-16-8-12(14)7-15-16/h2-8,10H,9,14H2,1H3.
What are the key properties of 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate?
1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate has a molecular weight of 245.28 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethyl 2-(4-aminopyrazol-1-yl)acetate is sourced from PubChem (CID 61285964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).