C18H23N3O3S3 — CID 6131526
N-morpholin-4-yl-6-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide (PubChem CID 6131526) has the molecular formula C18H23N3O3S3 and a molecular weight of 425.60 g/mol. Its IUPAC name is N-morpholin-4-yl-6-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide.
| Compound Name | N-morpholin-4-yl-6-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
|---|---|
| PubChem CID | 6131526 |
| Molecular Formula | C18H23N3O3S3 |
| Molecular Weight | 425.60 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | N-morpholin-4-yl-6-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]hexanamide |
| SMILES | O=C(CCCCCN1C(=O)/C(=C/c2cccs2)SC1=S)NN1CCOCC1 |
| InChI | InChI=1S/C18H23N3O3S3/c22-16(19-20-8-10-24-11-9-20)6-2-1-3-7-21-17(23)15(27-18(21)25)13-14-5-4-12-26-14/h4-5,12-13H,1-3,6-11H2,(H,19,22)/b15-13- |
| InChIKey | SMUSFPJFALMMCP-SQFISAMPSA-N |
| XLogP | 2.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|