C15H17N3O3 — CID 61315853
(2-carbamoylphenyl)methyl 4-amino-1-ethylpyrrole-2-carboxylate (PubChem CID 61315853) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is (2-carbamoylphenyl)methyl 4-amino-1-ethylpyrrole-2-carboxylate.
| Compound Name | (2-carbamoylphenyl)methyl 4-amino-1-ethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 61315853 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (2-carbamoylphenyl)methyl 4-amino-1-ethylpyrrole-2-carboxylate |
| SMILES | CCn1cc(N)cc1C(=O)OCc1ccccc1C(N)=O |
| InChI | InChI=1S/C15H17N3O3/c1-2-18-8-11(16)7-13(18)15(20)21-9-10-5-3-4-6-12(10)14(17)19/h3-8H,2,9,16H2,1H3,(H2,17,19) |
| InChIKey | JINJLKANAXDXMI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 100.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |