C10H15N3O6 — CID 61329467
2-[2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-2-oxoethoxy]acetic acid (PubChem CID 61329467) has the molecular formula C10H15N3O6 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 61329467 |
| Molecular Formula | C10H15N3O6 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[2-[[2-(cyclopropylamino)-2-oxoethyl]carbamoylamino]-2-oxoethoxy]acetic acid |
| SMILES | O=C(O)COCC(=O)NC(=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C10H15N3O6/c14-7(12-6-1-2-6)3-11-10(18)13-8(15)4-19-5-9(16)17/h6H,1-5H2,(H,12,14)(H,16,17)(H2,11,13,15,18) |
| InChIKey | PNFLXVMUKJRJEO-UHFFFAOYSA-N |
| XLogP | -1.81 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |