C14H17NO5 — CID 613303
dimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3-dicarboxylate (PubChem CID 613303) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is dimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3-dicarboxylate.
| Compound Name | dimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3-dicarboxylate |
|---|---|
| PubChem CID | 613303 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | dimethyl 2-methyl-5-phenyl-1,2-oxazolidine-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccccc2)ON1C |
| InChI | InChI=1S/C14H17NO5/c1-15-14(12(16)18-2,13(17)19-3)9-11(20-15)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3 |
| InChIKey | SKFIEHHPUAOZNR-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|