C13H24N2S — CID 61331075
1-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-1-amine (PubChem CID 61331075) has the molecular formula C13H24N2S and a molecular weight of 240.42 g/mol. Its IUPAC name is 1-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-1-amine.
| Compound Name | 1-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-1-amine |
|---|---|
| PubChem CID | 61331075 |
| Molecular Formula | C13H24N2S |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-(4-propan-2-yl-1,3-thiazol-2-yl)heptan-1-amine |
| SMILES | CCCCCCC(N)c1nc(C(C)C)cs1 |
| InChI | InChI=1S/C13H24N2S/c1-4-5-6-7-8-11(14)13-15-12(9-16-13)10(2)3/h9-11H,4-8,14H2,1-3H3 |
| InChIKey | BZURLDLISRYEPL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|