C14H26N2S — CID 61331537
1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methylheptan-1-amine (PubChem CID 61331537) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methylheptan-1-amine.
| Compound Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methylheptan-1-amine |
|---|---|
| PubChem CID | 61331537 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-(4-ethyl-5-methyl-1,3-thiazol-2-yl)-N-methylheptan-1-amine |
| SMILES | CCCCCCC(NC)c1nc(CC)c(C)s1 |
| InChI | InChI=1S/C14H26N2S/c1-5-7-8-9-10-13(15-4)14-16-12(6-2)11(3)17-14/h13,15H,5-10H2,1-4H3 |
| InChIKey | HYGRUVIFKOZHHG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|