C16H21N3S — CID 61338645
4-ethyl-1-(4-pyridin-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine (PubChem CID 61338645) has the molecular formula C16H21N3S and a molecular weight of 287.43 g/mol. Its IUPAC name is 4-ethyl-1-(4-pyridin-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine.
| Compound Name | 4-ethyl-1-(4-pyridin-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 61338645 |
| Molecular Formula | C16H21N3S |
| Molecular Weight | 287.43 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-ethyl-1-(4-pyridin-2-yl-1,3-thiazol-2-yl)cyclohexan-1-amine |
| SMILES | CCC1CCC(N)(c2nc(-c3ccccn3)cs2)CC1 |
| InChI | InChI=1S/C16H21N3S/c1-2-12-6-8-16(17,9-7-12)15-19-14(11-20-15)13-5-3-4-10-18-13/h3-5,10-12H,2,6-9,17H2,1H3 |
| InChIKey | WVPBGEGEUIIILE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |