C21H29N3O4 — CID 6134995
ethyl (3Z)-3-[[4-(cyclohexanecarbonylamino)benzoyl]hydrazinylidene]-2-methylbutanoate (PubChem CID 6134995) has the molecular formula C21H29N3O4 and a molecular weight of 387.48 g/mol. Its IUPAC name is ethyl (3Z)-3-[[4-(cyclohexanecarbonylamino)benzoyl]hydrazinylidene]-2-methylbutanoate.
| Compound Name | ethyl (3Z)-3-[[4-(cyclohexanecarbonylamino)benzoyl]hydrazinylidene]-2-methylbutanoate |
|---|---|
| PubChem CID | 6134995 |
| Molecular Formula | C21H29N3O4 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | ethyl (3Z)-3-[[4-(cyclohexanecarbonylamino)benzoyl]hydrazinylidene]-2-methylbutanoate |
| SMILES | CCOC(=O)C(C)/C(C)=N\NC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H29N3O4/c1-4-28-21(27)14(2)15(3)23-24-20(26)17-10-12-18(13-11-17)22-19(25)16-8-6-5-7-9-16/h10-14,16H,4-9H2,1-3H3,(H,22,25)(H,24,26)/b23-15- |
| InChIKey | USCOAQJCOMCXRC-HAHDFKILSA-N |
| XLogP | 3.51 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|