C12H8BrFN2O4 — CID 61359885
5-bromo-6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione (PubChem CID 61359885) has the molecular formula C12H8BrFN2O4 and a molecular weight of 343.11 g/mol. Its IUPAC name is 5-bromo-6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione.
| Compound Name | 5-bromo-6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 61359885 |
| Molecular Formula | C12H8BrFN2O4 |
| Molecular Weight | 343.11 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | 5-bromo-6-fluoro-1-[(2-oxo-1,3-oxazolidin-5-yl)methyl]indole-2,3-dione |
| SMILES | O=C1NCC(CN2C(=O)C(=O)c3cc(Br)c(F)cc32)O1 |
| InChI | InChI=1S/C12H8BrFN2O4/c13-7-1-6-9(2-8(7)14)16(11(18)10(6)17)4-5-3-15-12(19)20-5/h1-2,5H,3-4H2,(H,15,19) |
| InChIKey | UQCGEXGOBPGUOV-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.11 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|