C14H23N3O — CID 61362907
N-amino-N'-tert-butyl-3-(4-methoxyphenyl)propanimidamide (PubChem CID 61362907) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is N-amino-N'-tert-butyl-3-(4-methoxyphenyl)propanimidamide.
| Compound Name | N-amino-N'-tert-butyl-3-(4-methoxyphenyl)propanimidamide |
|---|---|
| PubChem CID | 61362907 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N-amino-N'-tert-butyl-3-(4-methoxyphenyl)propanimidamide |
| SMILES | COc1ccc(CC/C(=N/C(C)(C)C)NN)cc1 |
| InChI | InChI=1S/C14H23N3O/c1-14(2,3)16-13(17-15)10-7-11-5-8-12(18-4)9-6-11/h5-6,8-9H,7,10,15H2,1-4H3,(H,16,17) |
| InChIKey | JPPNGXBTPJGLEJ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|