About N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide
N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide (PubChem CID 61362567) has the molecular formula C16H19N3O
and a molecular weight of 269.35 g/mol. Its IUPAC name is N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide.
Molecular Properties
| Compound Name | N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide |
| PubChem CID | 61362567 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide |
| SMILES | COc1ccc(CC/C(=N/c2ccccc2)NN)cc1 |
| InChI | InChI=1S/C16H19N3O/c1-20-15-10-7-13(8-11-15)9-12-16(19-17)18-14-5-3-2-4-6-14/h2-8,10-11H,9,12,17H2,1H3,(H,18,19) |
| InChIKey | PPKXWISYQGTUFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide?
The IUPAC name of N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide (CID 61362567) is N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide.
What is the SMILES notation for N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide?
The canonical SMILES for N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide is COc1ccc(CC/C(=N/c2ccccc2)NN)cc1.
What is the InChIKey of N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide?
The InChIKey is PPKXWISYQGTUFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O/c1-20-15-10-7-13(8-11-15)9-12-16(19-17)18-14-5-3-2-4-6-14/h2-8,10-11H,9,12,17H2,1H3,(H,18,19).
What are the key properties of N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide?
N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide has a molecular weight of 269.35 g/mol, XLogP of 2.82, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-3-(4-methoxyphenyl)-N'-phenylpropanimidamide is sourced from PubChem (CID 61362567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).