C16H10BrNO4S2 — CID 6136570
3-[(5E)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid (PubChem CID 6136570) has the molecular formula C16H10BrNO4S2 and a molecular weight of 424.30 g/mol. Its IUPAC name is 3-[(5E)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid.
| Compound Name | 3-[(5E)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 6136570 |
| Molecular Formula | C16H10BrNO4S2 |
| Molecular Weight | 424.30 g/mol |
| Exact Mass | 422.92 |
| IUPAC Name | 3-[(5E)-5-[(5-bromofuran-2-yl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzoic acid |
| SMILES | Cc1ccc(C(=O)O)cc1N1C(=O)/C(=C\c2ccc(Br)o2)SC1=S |
| InChI | InChI=1S/C16H10BrNO4S2/c1-8-2-3-9(15(20)21)6-11(8)18-14(19)12(24-16(18)23)7-10-4-5-13(17)22-10/h2-7H,1H3,(H,20,21)/b12-7+ |
| InChIKey | ILKVURNFTIMERZ-KPKJPENVSA-N |
| XLogP | 4.45 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|