C16H20N2O5S — CID 613676
ethyl 2-[[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carbonyl]amino]acetate (PubChem CID 613676) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 2-[[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 613676 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 2-[[1-(4-methylphenyl)sulfonyl-2,5-dihydropyrrole-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C1C=CCN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H20N2O5S/c1-3-23-15(19)11-17-16(20)14-5-4-10-18(14)24(21,22)13-8-6-12(2)7-9-13/h4-9,14H,3,10-11H2,1-2H3,(H,17,20) |
| InChIKey | BGGHCLOLMKPRER-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|