C13H18F2N2O3S — CID 61368809
2-(4-amino-2,6-difluorophenyl)sulfonyl-N-(2-methylpropyl)propanamide (PubChem CID 61368809) has the molecular formula C13H18F2N2O3S and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-(4-amino-2,6-difluorophenyl)sulfonyl-N-(2-methylpropyl)propanamide.
| Compound Name | 2-(4-amino-2,6-difluorophenyl)sulfonyl-N-(2-methylpropyl)propanamide |
|---|---|
| PubChem CID | 61368809 |
| Molecular Formula | C13H18F2N2O3S |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-amino-2,6-difluorophenyl)sulfonyl-N-(2-methylpropyl)propanamide |
| SMILES | CC(C)CNC(=O)C(C)S(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C13H18F2N2O3S/c1-7(2)6-17-13(18)8(3)21(19,20)12-10(14)4-9(16)5-11(12)15/h4-5,7-8H,6,16H2,1-3H3,(H,17,18) |
| InChIKey | YMPWEESRSALFMP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|