C9H11N3O4S — CID 61369547
2-(4-aminophenyl)sulfonyl-N-carbamoylacetamide (PubChem CID 61369547) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfonyl-N-carbamoylacetamide.
| Compound Name | 2-(4-aminophenyl)sulfonyl-N-carbamoylacetamide |
|---|---|
| PubChem CID | 61369547 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-(4-aminophenyl)sulfonyl-N-carbamoylacetamide |
| SMILES | NC(=O)NC(=O)CS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H11N3O4S/c10-6-1-3-7(4-2-6)17(15,16)5-8(13)12-9(11)14/h1-4H,5,10H2,(H3,11,12,13,14) |
| InChIKey | MLCNZWQWKGQOEQ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|