C9H12N4O3S — CID 154194116
2-(4-aminophenyl)sulfonyl-N-(diaminomethylidene)acetamide (PubChem CID 154194116) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is 2-(4-aminophenyl)sulfonyl-N-(diaminomethylidene)acetamide.
| Compound Name | 2-(4-aminophenyl)sulfonyl-N-(diaminomethylidene)acetamide |
|---|---|
| PubChem CID | 154194116 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-(4-aminophenyl)sulfonyl-N-(diaminomethylidene)acetamide |
| SMILES | NC(N)=NC(=O)CS(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C9H12N4O3S/c10-6-1-3-7(4-2-6)17(15,16)5-8(14)13-9(11)12/h1-4H,5,10H2,(H4,11,12,13,14) |
| InChIKey | AMLMSUSAJYIXNG-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|