C15H13BrN2O3 — CID 61375305
5-bromo-3-nitro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine (PubChem CID 61375305) has the molecular formula C15H13BrN2O3 and a molecular weight of 349.18 g/mol. Its IUPAC name is 5-bromo-3-nitro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine.
| Compound Name | 5-bromo-3-nitro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine |
|---|---|
| PubChem CID | 61375305 |
| Molecular Formula | C15H13BrN2O3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 5-bromo-3-nitro-2-(1,2,3,4-tetrahydronaphthalen-1-yloxy)pyridine |
| SMILES | O=[N+]([O-])c1cc(Br)cnc1OC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H13BrN2O3/c16-11-8-13(18(19)20)15(17-9-11)21-14-7-3-5-10-4-1-2-6-12(10)14/h1-2,4,6,8-9,14H,3,5,7H2 |
| InChIKey | YOODXUQIKMQEFC-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 65.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|