C14H23N3S — CID 61378479
6-[bis(2-methylpropyl)amino]pyridine-3-carbothioamide (PubChem CID 61378479) has the molecular formula C14H23N3S and a molecular weight of 265.43 g/mol. Its IUPAC name is 6-[bis(2-methylpropyl)amino]pyridine-3-carbothioamide.
| Compound Name | 6-[bis(2-methylpropyl)amino]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 61378479 |
| Molecular Formula | C14H23N3S |
| Molecular Weight | 265.43 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 6-[bis(2-methylpropyl)amino]pyridine-3-carbothioamide |
| SMILES | CC(C)CN(CC(C)C)c1ccc(C(N)=S)cn1 |
| InChI | InChI=1S/C14H23N3S/c1-10(2)8-17(9-11(3)4)13-6-5-12(7-16-13)14(15)18/h5-7,10-11H,8-9H2,1-4H3,(H2,15,18) |
| InChIKey | SGGHETCFDYTGAR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|