C9H12N2O3S2 — CID 61382894
4-(5-methylpyrimidin-2-yl)sulfanyl-1,1-dioxothiolan-3-ol (PubChem CID 61382894) has the molecular formula C9H12N2O3S2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 4-(5-methylpyrimidin-2-yl)sulfanyl-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(5-methylpyrimidin-2-yl)sulfanyl-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 61382894 |
| Molecular Formula | C9H12N2O3S2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 4-(5-methylpyrimidin-2-yl)sulfanyl-1,1-dioxothiolan-3-ol |
| SMILES | Cc1cnc(SC2CS(=O)(=O)CC2O)nc1 |
| InChI | InChI=1S/C9H12N2O3S2/c1-6-2-10-9(11-3-6)15-8-5-16(13,14)4-7(8)12/h2-3,7-8,12H,4-5H2,1H3 |
| InChIKey | HOYFNUVXDFHSLA-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |