C12H13ClN4OS — CID 61384636
N-(4-amino-2-chlorophenyl)-2-(1-methylpyrazol-4-yl)sulfanylacetamide (PubChem CID 61384636) has the molecular formula C12H13ClN4OS and a molecular weight of 296.78 g/mol. Its IUPAC name is N-(4-amino-2-chlorophenyl)-2-(1-methylpyrazol-4-yl)sulfanylacetamide.
| Compound Name | N-(4-amino-2-chlorophenyl)-2-(1-methylpyrazol-4-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 61384636 |
| Molecular Formula | C12H13ClN4OS |
| Molecular Weight | 296.78 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | N-(4-amino-2-chlorophenyl)-2-(1-methylpyrazol-4-yl)sulfanylacetamide |
| SMILES | Cn1cc(SCC(=O)Nc2ccc(N)cc2Cl)cn1 |
| InChI | InChI=1S/C12H13ClN4OS/c1-17-6-9(5-15-17)19-7-12(18)16-11-3-2-8(14)4-10(11)13/h2-6H,7,14H2,1H3,(H,16,18) |
| InChIKey | RZBKLZKMTOYHOI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.78 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|